C18H26N4O2 — CID 126449238
1-[(1-hydroxycyclohexyl)methyl]-3-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)ethyl]urea (PubChem CID 126449238) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 1-[(1-hydroxycyclohexyl)methyl]-3-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)ethyl]urea.
| Compound Name | 1-[(1-hydroxycyclohexyl)methyl]-3-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 126449238 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | 1-[(1-hydroxycyclohexyl)methyl]-3-[(1S)-1-(6-methyl-1H-benzimidazol-2-yl)ethyl]urea |
| SMILES | Cc1ccc2nc([C@H](C)NC(=O)NCC3(O)CCCCC3)[nH]c2c1 |
| InChI | InChI=1S/C18H26N4O2/c1-12-6-7-14-15(10-12)22-16(21-14)13(2)20-17(23)19-11-18(24)8-4-3-5-9-18/h6-7,10,13,24H,3-5,8-9,11H2,1-2H3,(H,21,22)(H2,19,20,23)/t13-/m0/s1 |
| InChIKey | LNJAEOSDTWYSNQ-ZDUSSCGKSA-N |
| XLogP | 2.93 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |