C19H26KN4O3S+ — CID 126468671
potassium N-[4-(dimethylaminodiazenyl)phenyl]sulfonyladamantane-1-carboxamide (PubChem CID 126468671) has the molecular formula C19H26KN4O3S+ and a molecular weight of 429.61 g/mol. Its IUPAC name is potassium N-[4-(dimethylaminodiazenyl)phenyl]sulfonyladamantane-1-carboxamide.
| Compound Name | potassium N-[4-(dimethylaminodiazenyl)phenyl]sulfonyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 126468671 |
| Molecular Formula | C19H26KN4O3S+ |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | potassium N-[4-(dimethylaminodiazenyl)phenyl]sulfonyladamantane-1-carboxamide |
| SMILES | CN(C)/N=N/c1ccc(S(=O)(=O)NC(=O)C23CC4CC(CC(C4)C2)C3)cc1.[K+] |
| InChI | InChI=1S/C19H26N4O3S.K/c1-23(2)22-20-16-3-5-17(6-4-16)27(25,26)21-18(24)19-10-13-7-14(11-19)9-15(8-13)12-19;/h3-6,13-15H,7-12H2,1-2H3,(H,21,24);/q;+1/b22-20+; |
| InChIKey | DRYAEPQZYXAHOJ-QPNALZDCSA-N |
| XLogP | 0.27 |
| TPSA | 91.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|