C21H22F3NO5S — CID 126495503
2-[(4aR,7aS)-5-[2-[3-(trifluoromethoxy)phenoxy]ethyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 126495503) has the molecular formula C21H22F3NO5S and a molecular weight of 457.47 g/mol. Its IUPAC name is 2-[(4aR,7aS)-5-[2-[3-(trifluoromethoxy)phenoxy]ethyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(4aR,7aS)-5-[2-[3-(trifluoromethoxy)phenoxy]ethyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 126495503 |
| Molecular Formula | C21H22F3NO5S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[(4aR,7aS)-5-[2-[3-(trifluoromethoxy)phenoxy]ethyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyran-2-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc(C2CC[C@@H]3C(CCOc4cccc(OC(F)(F)F)c4)CC[C@@H]3O2)n1 |
| InChI | InChI=1S/C21H22F3NO5S/c22-21(23,24)30-14-3-1-2-13(10-14)28-9-8-12-4-6-17-15(12)5-7-18(29-17)19-25-16(11-31-19)20(26)27/h1-3,10-12,15,17-18H,4-9H2,(H,26,27)/t12?,15-,17+,18?/m1/s1 |
| InChIKey | GFHCYAHXBOTQBX-XEXMDQGHSA-N |
| XLogP | 5.46 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |