C23H27NO5S — CID 137482635
2-[(3S,5aR,6R,8aS)-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 137482635) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is 2-[(3S,5aR,6R,8aS)-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[(3S,5aR,6R,8aS)-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 137482635 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-[(3S,5aR,6R,8aS)-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1csc([C@H]2CC[C@H]3[C@H](CC[C@@H]3/C=C/[C@@H](O)COc3ccccc3)OC2)n1 |
| InChI | InChI=1S/C23H27NO5S/c25-17(13-28-18-4-2-1-3-5-18)9-6-15-8-11-21-19(15)10-7-16(12-29-21)22-24-20(14-30-22)23(26)27/h1-6,9,14-17,19,21,25H,7-8,10-13H2,(H,26,27)/b9-6+/t15-,16-,17+,19+,21-/m0/s1 |
| InChIKey | YELIFLJWSVCLOK-RXCKOVBNSA-N |
| XLogP | 4.13 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|