C25H31NO6S — CID 68748782
ethyl 2-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]-1,3-thiazole-4-carboxylate (PubChem CID 68748782) has the molecular formula C25H31NO6S and a molecular weight of 473.59 g/mol. Its IUPAC name is ethyl 2-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 68748782 |
| Molecular Formula | C25H31NO6S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | ethyl 2-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc([C@H]2CC[C@@H]3[C@@H](C=C[C@@H](O)COc4ccccc4)[C@H](O)C[C@@H]3OC2)n1 |
| InChI | InChI=1S/C25H31NO6S/c1-2-30-25(29)21-15-33-24(26-21)16-8-10-20-19(22(28)12-23(20)32-13-16)11-9-17(27)14-31-18-6-4-3-5-7-18/h3-7,9,11,15-17,19-20,22-23,27-28H,2,8,10,12-14H2,1H3/t16-,17+,19+,20+,22+,23-/m0/s1 |
| InChIKey | FJHASNOUAPBXIX-MLBWIEORSA-N |
| XLogP | 3.58 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|