C28H34O6 — CID 68753590
ethyl 4-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]benzoate (PubChem CID 68753590) has the molecular formula C28H34O6 and a molecular weight of 466.57 g/mol. Its IUPAC name is ethyl 4-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]benzoate.
| Compound Name | ethyl 4-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]benzoate |
|---|---|
| PubChem CID | 68753590 |
| Molecular Formula | C28H34O6 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | ethyl 4-[(3S,5aR,6R,7R,8aS)-7-hydroxy-6-[(E,3R)-3-hydroxy-4-phenoxybut-1-enyl]-3,4,5,5a,6,7,8,8a-octahydro-2H-cyclopenta[b]oxepin-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc([C@@H]2CC[C@@H]3[C@@H](/C=C/[C@@H](O)COc4ccccc4)[C@H](O)C[C@@H]3OC2)cc1 |
| InChI | InChI=1S/C28H34O6/c1-2-32-28(31)20-10-8-19(9-11-20)21-12-14-25-24(26(30)16-27(25)34-17-21)15-13-22(29)18-33-23-6-4-3-5-7-23/h3-11,13,15,21-22,24-27,29-30H,2,12,14,16-18H2,1H3/b15-13+/t21-,22-,24-,25-,26-,27+/m1/s1 |
| InChIKey | QPTHFIRJORTOMK-JOMDUCRMSA-N |
| XLogP | 4.12 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|