C28H40O6 — CID 68747166
6-[(5aR,6R,7R,8aS)-7-hydroxy-6-(3-hydroxy-4-phenoxybut-1-enyl)-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]-2-propylhexanoic acid (PubChem CID 68747166) has the molecular formula C28H40O6 and a molecular weight of 472.62 g/mol. Its IUPAC name is 6-[(5aR,6R,7R,8aS)-7-hydroxy-6-(3-hydroxy-4-phenoxybut-1-enyl)-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]-2-propylhexanoic acid.
| Compound Name | 6-[(5aR,6R,7R,8aS)-7-hydroxy-6-(3-hydroxy-4-phenoxybut-1-enyl)-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]-2-propylhexanoic acid |
|---|---|
| PubChem CID | 68747166 |
| Molecular Formula | C28H40O6 |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 6-[(5aR,6R,7R,8aS)-7-hydroxy-6-(3-hydroxy-4-phenoxybut-1-enyl)-5,5a,6,7,8,8a-hexahydro-2H-cyclopenta[b]oxepin-3-yl]-2-propylhexanoic acid |
| SMILES | CCCC(CCCCC1=CC[C@@H]2[C@@H](C=CC(O)COc3ccccc3)[C@H](O)C[C@@H]2OC1)C(=O)O |
| InChI | InChI=1S/C28H40O6/c1-2-8-21(28(31)32)10-7-6-9-20-13-15-25-24(26(30)17-27(25)34-18-20)16-14-22(29)19-33-23-11-4-3-5-12-23/h3-5,11-14,16,21-22,24-27,29-30H,2,6-10,15,17-19H2,1H3,(H,31,32)/t21?,22?,24-,25-,26-,27+/m1/s1 |
| InChIKey | PBEHSDJQKHCEDX-LNSAOPJRSA-N |
| XLogP | 4.76 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|