C18H25NO5 — CID 126495766
1-O-methyl 4-O-[(2S,4Z,6Z)-3-methylidene-2-(2-methylpropanoylamino)octa-4,6-dienyl] (E)-but-2-enedioate (PubChem CID 126495766) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is 1-O-methyl 4-O-[(2S,4Z,6Z)-3-methylidene-2-(2-methylpropanoylamino)octa-4,6-dienyl] (E)-but-2-enedioate.
| Compound Name | 1-O-methyl 4-O-[(2S,4Z,6Z)-3-methylidene-2-(2-methylpropanoylamino)octa-4,6-dienyl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 126495766 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-O-methyl 4-O-[(2S,4Z,6Z)-3-methylidene-2-(2-methylpropanoylamino)octa-4,6-dienyl] (E)-but-2-enedioate |
| SMILES | C=C(/C=C\C=C/C)[C@@H](COC(=O)/C=C/C(=O)OC)NC(=O)C(C)C |
| InChI | InChI=1S/C18H25NO5/c1-6-7-8-9-14(4)15(19-18(22)13(2)3)12-24-17(21)11-10-16(20)23-5/h6-11,13,15H,4,12H2,1-3,5H3,(H,19,22)/b7-6-,9-8-,11-10+/t15-/m1/s1 |
| InChIKey | HVCMUDVMLKHRDB-NUZQTXNVSA-N |
| XLogP | 2.09 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|