C18H22N4OS — CID 126496544
(5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-ethylphenyl)methylamino]methanol (PubChem CID 126496544) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-ethylphenyl)methylamino]methanol.
| Compound Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-ethylphenyl)methylamino]methanol |
|---|---|
| PubChem CID | 126496544 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | (5-amino-3,4-dimethylthieno[2,3-c]pyridazin-6-yl)-[(4-ethylphenyl)methylamino]methanol |
| SMILES | CCc1ccc(CNC(O)c2sc3nnc(C)c(C)c3c2N)cc1 |
| InChI | InChI=1S/C18H22N4OS/c1-4-12-5-7-13(8-6-12)9-20-17(23)16-15(19)14-10(2)11(3)21-22-18(14)24-16/h5-8,17,20,23H,4,9,19H2,1-3H3 |
| InChIKey | HHASYKVPBQZJEB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|