C16H21N2P — CID 126497388
cyclopentyl-(1-methyl-2H-pyridin-6-yl)-pyridin-2-ylphosphane (PubChem CID 126497388) has the molecular formula C16H21N2P and a molecular weight of 272.33 g/mol. Its IUPAC name is cyclopentyl-(1-methyl-2H-pyridin-6-yl)-pyridin-2-ylphosphane.
| Compound Name | cyclopentyl-(1-methyl-2H-pyridin-6-yl)-pyridin-2-ylphosphane |
|---|---|
| PubChem CID | 126497388 |
| Molecular Formula | C16H21N2P |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | cyclopentyl-(1-methyl-2H-pyridin-6-yl)-pyridin-2-ylphosphane |
| SMILES | CN1CC=CC=C1P(c1ccccn1)C1CCCC1 |
| InChI | InChI=1S/C16H21N2P/c1-18-13-7-5-11-16(18)19(14-8-2-3-9-14)15-10-4-6-12-17-15/h4-7,10-12,14H,2-3,8-9,13H2,1H3 |
| InChIKey | VLXZSSLNVPADDB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|