C12H15N — CID 126516080
N-ethenyl-1-[(1E,3Z,7E)-8-methylcycloocta-1,3,7-trien-1-yl]methanimine (PubChem CID 126516080) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is N-ethenyl-1-[(1E,3Z,7E)-8-methylcycloocta-1,3,7-trien-1-yl]methanimine.
| Compound Name | N-ethenyl-1-[(1E,3Z,7E)-8-methylcycloocta-1,3,7-trien-1-yl]methanimine |
|---|---|
| PubChem CID | 126516080 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N-ethenyl-1-[(1E,3Z,7E)-8-methylcycloocta-1,3,7-trien-1-yl]methanimine |
| SMILES | C=C/N=C/C1=C/C=C\CC\C=C1\C |
| InChI | InChI=1S/C12H15N/c1-3-13-10-12-9-7-5-4-6-8-11(12)2/h3,5,7-10H,1,4,6H2,2H3/b7-5-,11-8-,12-9-,13-10+ |
| InChIKey | YZBSAMUWJNXHEX-DYOCDARJSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|