C12H12Br2N2O — CID 126535167
(Z,4Z)-2,3-dibromo-4-[methyl-(3-methylphenyl)hydrazinylidene]but-2-enal (PubChem CID 126535167) has the molecular formula C12H12Br2N2O and a molecular weight of 360.05 g/mol. Its IUPAC name is (Z,4Z)-2,3-dibromo-4-[methyl-(3-methylphenyl)hydrazinylidene]but-2-enal.
| Compound Name | (Z,4Z)-2,3-dibromo-4-[methyl-(3-methylphenyl)hydrazinylidene]but-2-enal |
|---|---|
| PubChem CID | 126535167 |
| Molecular Formula | C12H12Br2N2O |
| Molecular Weight | 360.05 g/mol |
| Exact Mass | 357.93 |
| IUPAC Name | (Z,4Z)-2,3-dibromo-4-[methyl-(3-methylphenyl)hydrazinylidene]but-2-enal |
| SMILES | Cc1cccc(N(C)/N=C\C(Br)=C(\Br)C=O)c1 |
| InChI | InChI=1S/C12H12Br2N2O/c1-9-4-3-5-10(6-9)16(2)15-7-11(13)12(14)8-17/h3-8H,1-2H3/b12-11-,15-7- |
| InChIKey | PPENVAROYKDSGB-LLPVMWJUSA-N |
| XLogP | 3.62 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.05 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|