C16H26N2O3 — CID 126554359
N'-hydroxy-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]octanediamide (PubChem CID 126554359) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is N'-hydroxy-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]octanediamide.
| Compound Name | N'-hydroxy-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]octanediamide |
|---|---|
| PubChem CID | 126554359 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N'-hydroxy-N-[(2E,4Z,6Z)-octa-2,4,6-trien-3-yl]octanediamide |
| SMILES | C/C=C\C=C/C(=C\C)NC(=O)CCCCCCC(=O)NO |
| InChI | InChI=1S/C16H26N2O3/c1-3-5-8-11-14(4-2)17-15(19)12-9-6-7-10-13-16(20)18-21/h3-5,8,11,21H,6-7,9-10,12-13H2,1-2H3,(H,17,19)(H,18,20)/b5-3-,11-8-,14-4+ |
| InChIKey | KVJYHFAJEHGHBI-WLJWNAEMSA-N |
| XLogP | 2.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|