C14H22N2O3 — CID 123970780
N-cyclohexa-1,3-dien-1-yl-N'-hydroxyoctanediamide (PubChem CID 123970780) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-cyclohexa-1,3-dien-1-yl-N'-hydroxyoctanediamide.
| Compound Name | N-cyclohexa-1,3-dien-1-yl-N'-hydroxyoctanediamide |
|---|---|
| PubChem CID | 123970780 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-cyclohexa-1,3-dien-1-yl-N'-hydroxyoctanediamide |
| SMILES | O=C(CCCCCCC(=O)NC1=CC=CCC1)NO |
| InChI | InChI=1S/C14H22N2O3/c17-13(15-12-8-4-3-5-9-12)10-6-1-2-7-11-14(18)16-19/h3-4,8,19H,1-2,5-7,9-11H2,(H,15,17)(H,16,18) |
| InChIKey | UCTLEVZHWJGKSC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|