C16H28N2O3 — CID 123284208
N-hexa-2,4-dien-2-yl-N'-hydroxydecanediamide (PubChem CID 123284208) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-hexa-2,4-dien-2-yl-N'-hydroxydecanediamide.
| Compound Name | N-hexa-2,4-dien-2-yl-N'-hydroxydecanediamide |
|---|---|
| PubChem CID | 123284208 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-hexa-2,4-dien-2-yl-N'-hydroxydecanediamide |
| SMILES | CC=CC=C(C)NC(=O)CCCCCCCCC(=O)NO |
| InChI | InChI=1S/C16H28N2O3/c1-3-4-11-14(2)17-15(19)12-9-7-5-6-8-10-13-16(20)18-21/h3-4,11,21H,5-10,12-13H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | HKPFUYPMACFZEJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|