C11H20N2O3 — CID 143666608
N-[(E)-but-2-en-2-yl]-N'-hydroxyheptanediamide (PubChem CID 143666608) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is N-[(E)-but-2-en-2-yl]-N'-hydroxyheptanediamide.
| Compound Name | N-[(E)-but-2-en-2-yl]-N'-hydroxyheptanediamide |
|---|---|
| PubChem CID | 143666608 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | N-[(E)-but-2-en-2-yl]-N'-hydroxyheptanediamide |
| SMILES | C/C=C(\C)NC(=O)CCCCCC(=O)NO |
| InChI | InChI=1S/C11H20N2O3/c1-3-9(2)12-10(14)7-5-4-6-8-11(15)13-16/h3,16H,4-8H2,1-2H3,(H,12,14)(H,13,15)/b9-3+ |
| InChIKey | BISPHUPNSAKXSW-YCRREMRBSA-N |
| XLogP | 1.48 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|