C14H20O3S — CID 126561186
4-[(3,5-dimethylphenoxy)methyl]thiane 1,1-dioxide (PubChem CID 126561186) has the molecular formula C14H20O3S and a molecular weight of 268.38 g/mol. Its IUPAC name is 4-[(3,5-dimethylphenoxy)methyl]thiane 1,1-dioxide.
| Compound Name | 4-[(3,5-dimethylphenoxy)methyl]thiane 1,1-dioxide |
|---|---|
| PubChem CID | 126561186 |
| Molecular Formula | C14H20O3S |
| Molecular Weight | 268.38 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-[(3,5-dimethylphenoxy)methyl]thiane 1,1-dioxide |
| SMILES | Cc1cc(C)cc(OCC2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C14H20O3S/c1-11-7-12(2)9-14(8-11)17-10-13-3-5-18(15,16)6-4-13/h7-9,13H,3-6,10H2,1-2H3 |
| InChIKey | BQHQJQHUIMMZQW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |