C25H20O2S — CID 12657262
(2,4,6-triphenylthiopyran-1-yl) acetate (PubChem CID 12657262) has the molecular formula C25H20O2S and a molecular weight of 384.50 g/mol. Its IUPAC name is (2,4,6-triphenylthiopyran-1-yl) acetate.
| Compound Name | (2,4,6-triphenylthiopyran-1-yl) acetate |
|---|---|
| PubChem CID | 12657262 |
| Molecular Formula | C25H20O2S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | (2,4,6-triphenylthiopyran-1-yl) acetate |
| SMILES | CC(=O)OS1=C(c2ccccc2)C=C(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C25H20O2S/c1-19(26)27-28-24(21-13-7-3-8-14-21)17-23(20-11-5-2-6-12-20)18-25(28)22-15-9-4-10-16-22/h2-18H,1H3 |
| InChIKey | ZCDRTGAOTLTJNK-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|