C27H27ClN2S — CID 162408083
4-[1-chloro-6-[4-(dimethylamino)phenyl]-4-phenylthiopyran-2-yl]-N,N-dimethylaniline (PubChem CID 162408083) has the molecular formula C27H27ClN2S and a molecular weight of 447.05 g/mol. Its IUPAC name is 4-[1-chloro-6-[4-(dimethylamino)phenyl]-4-phenylthiopyran-2-yl]-N,N-dimethylaniline.
| Compound Name | 4-[1-chloro-6-[4-(dimethylamino)phenyl]-4-phenylthiopyran-2-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 162408083 |
| Molecular Formula | C27H27ClN2S |
| Molecular Weight | 447.05 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 4-[1-chloro-6-[4-(dimethylamino)phenyl]-4-phenylthiopyran-2-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2=CC(c3ccccc3)=CC(c3ccc(N(C)C)cc3)=S2Cl)cc1 |
| InChI | InChI=1S/C27H27ClN2S/c1-29(2)24-14-10-21(11-15-24)26-18-23(20-8-6-5-7-9-20)19-27(31(26)28)22-12-16-25(17-13-22)30(3)4/h5-19H,1-4H3 |
| InChIKey | OLSNKWSHWMTBCO-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.05 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|