C19H17IS2 — CID 134911240
2-ethylsulfanyl-1-iodo-4,6-diphenylthiopyran (PubChem CID 134911240) has the molecular formula C19H17IS2 and a molecular weight of 436.38 g/mol. Its IUPAC name is 2-ethylsulfanyl-1-iodo-4,6-diphenylthiopyran.
| Compound Name | 2-ethylsulfanyl-1-iodo-4,6-diphenylthiopyran |
|---|---|
| PubChem CID | 134911240 |
| Molecular Formula | C19H17IS2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.98 |
| IUPAC Name | 2-ethylsulfanyl-1-iodo-4,6-diphenylthiopyran |
| SMILES | CCSC1=S(I)C(c2ccccc2)=CC(c2ccccc2)=C1 |
| InChI | InChI=1S/C19H17IS2/c1-2-21-19-14-17(15-9-5-3-6-10-15)13-18(22(19)20)16-11-7-4-8-12-16/h3-14H,2H2,1H3 |
| InChIKey | NFPGEVWWOPGRAI-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|