C27H27PS2 — CID 134912936
1,1-bis(ethylsulfanyl)-2,4,6-triphenyl-1λ5-phosphacyclohexa-1,3,5-triene (PubChem CID 134912936) has the molecular formula C27H27PS2 and a molecular weight of 446.62 g/mol. Its IUPAC name is 1,1-bis(ethylsulfanyl)-2,4,6-triphenyl-1λ5-phosphacyclohexa-1,3,5-triene.
| Compound Name | 1,1-bis(ethylsulfanyl)-2,4,6-triphenyl-1λ5-phosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 134912936 |
| Molecular Formula | C27H27PS2 |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 1,1-bis(ethylsulfanyl)-2,4,6-triphenyl-1λ5-phosphacyclohexa-1,3,5-triene |
| SMILES | CCSP1(SCC)=C(c2ccccc2)C=C(c2ccccc2)C=C1c1ccccc1 |
| InChI | InChI=1S/C27H27PS2/c1-3-29-28(30-4-2)26(23-16-10-6-11-17-23)20-25(22-14-8-5-9-15-22)21-27(28)24-18-12-7-13-19-24/h5-21H,3-4H2,1-2H3 |
| InChIKey | GEBYJWTVLRWVES-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|