C19H23FN2O3 — CID 126573658
tert-butyl (2R)-2-(6-fluoroquinolin-4-yl)oxypiperidine-1-carboxylate (PubChem CID 126573658) has the molecular formula C19H23FN2O3 and a molecular weight of 346.40 g/mol. Its IUPAC name is tert-butyl (2R)-2-(6-fluoroquinolin-4-yl)oxypiperidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(6-fluoroquinolin-4-yl)oxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 126573658 |
| Molecular Formula | C19H23FN2O3 |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | tert-butyl (2R)-2-(6-fluoroquinolin-4-yl)oxypiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1Oc1ccnc2ccc(F)cc12 |
| InChI | InChI=1S/C19H23FN2O3/c1-19(2,3)25-18(23)22-11-5-4-6-17(22)24-16-9-10-21-15-8-7-13(20)12-14(15)16/h7-10,12,17H,4-6,11H2,1-3H3/t17-/m1/s1 |
| InChIKey | ARALGNJYLYMGIR-QGZVFWFLSA-N |
| XLogP | 4.50 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |