C20H17F5N4O2 — CID 126574464
N-[3-[(3S,4aS,7aS)-2-amino-3-fluoro-3-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4,5-difluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 126574464) has the molecular formula C20H17F5N4O2 and a molecular weight of 440.37 g/mol. Its IUPAC name is N-[3-[(3S,4aS,7aS)-2-amino-3-fluoro-3-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4,5-difluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-[(3S,4aS,7aS)-2-amino-3-fluoro-3-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4,5-difluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 126574464 |
| Molecular Formula | C20H17F5N4O2 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | N-[3-[(3S,4aS,7aS)-2-amino-3-fluoro-3-(fluoromethyl)-4,4a,5,7-tetrahydrofuro[3,4-b]pyridin-7a-yl]-4,5-difluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | NC1=N[C@@]2(c3cc(NC(=O)c4ccc(F)cn4)cc(F)c3F)COC[C@H]2C[C@@]1(F)CF |
| InChI | InChI=1S/C20H17F5N4O2/c21-8-19(25)5-10-7-31-9-20(10,29-18(19)26)13-3-12(4-14(23)16(13)24)28-17(30)15-2-1-11(22)6-27-15/h1-4,6,10H,5,7-9H2,(H2,26,29)(H,28,30)/t10-,19-,20+/m1/s1 |
| InChIKey | RPDUUTMKPQGXOA-NIXNKXAPSA-N |
| XLogP | 3.03 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |