C19H19FN4O3 — CID 53251820
5-[3-(2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-N-methylpyridine-2-carboxamide (PubChem CID 53251820) has the molecular formula C19H19FN4O3 and a molecular weight of 370.38 g/mol. Its IUPAC name is 5-[3-(2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-N-methylpyridine-2-carboxamide.
| Compound Name | 5-[3-(2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 53251820 |
| Molecular Formula | C19H19FN4O3 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 5-[3-(2-amino-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-7a-yl)-4-fluorophenyl]-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2ccc(F)c(C34COCC3COC(N)=N4)c2)cn1 |
| InChI | InChI=1S/C19H19FN4O3/c1-22-17(25)16-5-3-12(7-23-16)11-2-4-15(20)14(6-11)19-10-26-8-13(19)9-27-18(21)24-19/h2-7,13H,8-10H2,1H3,(H2,21,24)(H,22,25) |
| InChIKey | FZWQYJRCJVSWFC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |