C15H21N7O7 — CID 126574788
[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-tritiomethyl] N-[(2S,3R)-2-amino-3-hydroxybutanoyl]carbamate (PubChem CID 126574788) has the molecular formula C15H21N7O7 and a molecular weight of 413.38 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-tritiomethyl] N-[(2S,3R)-2-amino-3-hydroxybutanoyl]carbamate.
| Compound Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-tritiomethyl] N-[(2S,3R)-2-amino-3-hydroxybutanoyl]carbamate |
|---|---|
| PubChem CID | 126574788 |
| Molecular Formula | C15H21N7O7 |
| Molecular Weight | 413.38 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-tritiomethyl] N-[(2S,3R)-2-amino-3-hydroxybutanoyl]carbamate |
| SMILES | [3H]C(OC(=O)NC(=O)[C@@H](N)[C@@H](C)O)[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21N7O7/c1-5(23)7(16)13(26)21-15(27)28-2-6-9(24)10(25)14(29-6)22-4-20-8-11(17)18-3-19-12(8)22/h3-7,9-10,14,23-25H,2,16H2,1H3,(H2,17,18,19)(H,21,26,27)/t5-,6-,7+,9-,10-,14-/m1/s1/i2T/t2?,5-,6-,7+,9-,10-,14- |
| InChIKey | PEIYJWMNVUZISO-KVAUIWESSA-N |
| XLogP | -3.01 |
| TPSA | 220.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.38 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |