About [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate
[4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate (PubChem CID 126575037) has the molecular formula C22H18Cl2O4
and a molecular weight of 417.29 g/mol. Its IUPAC name is [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate.
Molecular Properties
| Compound Name | [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate |
| PubChem CID | 126575037 |
| Molecular Formula | C22H18Cl2O4 |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate |
| SMILES | O=C(Oc1ccc(OC(O)c2ccc(CCl)cc2)cc1)c1ccc(CCl)cc1 |
| InChI | InChI=1S/C22H18Cl2O4/c23-13-15-1-5-17(6-2-15)21(25)27-19-9-11-20(12-10-19)28-22(26)18-7-3-16(14-24)4-8-18/h1-12,21,25H,13-14H2 |
| InChIKey | ZCNGLBKBPAFTME-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate?
The IUPAC name of [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate (CID 126575037) is [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate.
What is the SMILES notation for [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate?
The canonical SMILES for [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate is O=C(Oc1ccc(OC(O)c2ccc(CCl)cc2)cc1)c1ccc(CCl)cc1.
What is the InChIKey of [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate?
The InChIKey is ZCNGLBKBPAFTME-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18Cl2O4/c23-13-15-1-5-17(6-2-15)21(25)27-19-9-11-20(12-10-19)28-22(26)18-7-3-16(14-24)4-8-18/h1-12,21,25H,13-14H2.
What are the key properties of [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate?
[4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate has a molecular weight of 417.29 g/mol, XLogP of 5.45, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[[4-(chloromethyl)phenyl]-hydroxymethoxy]phenyl] 4-(chloromethyl)benzoate is sourced from PubChem (CID 126575037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).