C19H21FN2O2 — CID 126581172
(1R,2S,3S)-2-[(3Z)-4-cyclopropyl-4-(ethylideneamino)buta-1,3-dien-2-yl]-1-fluoro-N-hydroxy-3-phenylcyclopropane-1-carboxamide (PubChem CID 126581172) has the molecular formula C19H21FN2O2 and a molecular weight of 328.39 g/mol. Its IUPAC name is (1R,2S,3S)-2-[(3Z)-4-cyclopropyl-4-(ethylideneamino)buta-1,3-dien-2-yl]-1-fluoro-N-hydroxy-3-phenylcyclopropane-1-carboxamide.
| Compound Name | (1R,2S,3S)-2-[(3Z)-4-cyclopropyl-4-(ethylideneamino)buta-1,3-dien-2-yl]-1-fluoro-N-hydroxy-3-phenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 126581172 |
| Molecular Formula | C19H21FN2O2 |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (1R,2S,3S)-2-[(3Z)-4-cyclopropyl-4-(ethylideneamino)buta-1,3-dien-2-yl]-1-fluoro-N-hydroxy-3-phenylcyclopropane-1-carboxamide |
| SMILES | C=C(/C=C(\N=C\C)C1CC1)[C@@H]1[C@@H](c2ccccc2)[C@@]1(F)C(=O)NO |
| InChI | InChI=1S/C19H21FN2O2/c1-3-21-15(13-9-10-13)11-12(2)16-17(14-7-5-4-6-8-14)19(16,20)18(23)22-24/h3-8,11,13,16-17,24H,2,9-10H2,1H3,(H,22,23)/b15-11-,21-3+/t16-,17-,19-/m1/s1 |
| InChIKey | DSELGCNKCWMYJX-LOFBYXMSSA-N |
| XLogP | 3.55 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|