C39H31N3O2 — CID 126605437
5-(methylamino)-2-[[4-(N-phenylanilino)phenyl]-(4-phenyliminocyclohexa-2,5-dien-1-ylidene)methyl]benzoic acid (PubChem CID 126605437) has the molecular formula C39H31N3O2 and a molecular weight of 573.70 g/mol. Its IUPAC name is 5-(methylamino)-2-[[4-(N-phenylanilino)phenyl]-(4-phenyliminocyclohexa-2,5-dien-1-ylidene)methyl]benzoic acid.
| Compound Name | 5-(methylamino)-2-[[4-(N-phenylanilino)phenyl]-(4-phenyliminocyclohexa-2,5-dien-1-ylidene)methyl]benzoic acid |
|---|---|
| PubChem CID | 126605437 |
| Molecular Formula | C39H31N3O2 |
| Molecular Weight | 573.70 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | 5-(methylamino)-2-[[4-(N-phenylanilino)phenyl]-(4-phenyliminocyclohexa-2,5-dien-1-ylidene)methyl]benzoic acid |
| SMILES | CNc1ccc(C(=C2C=CC(=Nc3ccccc3)C=C2)c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(C(=O)O)c1 |
| InChI | InChI=1S/C39H31N3O2/c1-40-32-23-26-36(37(27-32)39(43)44)38(28-17-21-31(22-18-28)41-30-11-5-2-6-12-30)29-19-24-35(25-20-29)42(33-13-7-3-8-14-33)34-15-9-4-10-16-34/h2-27,40H,1H3,(H,43,44)/b38-28-,41-31+ |
| InChIKey | PSVZTUJETRGUKR-GVCMUMHNSA-N |
| XLogP | 9.60 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.70 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|