C36H33Cl3N4O3S — CID 126616835
4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-chloro-N-methylbenzamide (PubChem CID 126616835) has the molecular formula C36H33Cl3N4O3S and a molecular weight of 708.11 g/mol. Its IUPAC name is 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-chloro-N-methylbenzamide.
| Compound Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-chloro-N-methylbenzamide |
|---|---|
| PubChem CID | 126616835 |
| Molecular Formula | C36H33Cl3N4O3S |
| Molecular Weight | 708.11 g/mol |
| Exact Mass | 706.13 |
| IUPAC Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-chloro-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(S(=O)(=O)N2CCC(c3c4cc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)ccc4nn3C3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C36H33Cl3N4O3S/c1-40-36(44)30-14-13-29(21-32(30)39)47(45,46)42-18-16-24(17-19-42)35-31-20-25(6-15-33(31)41-43(35)28-11-12-28)34(22-2-7-26(37)8-3-22)23-4-9-27(38)10-5-23/h2-10,13-15,20-21,24,28,34H,11-12,16-19H2,1H3,(H,40,44) |
| InChIKey | WYMNXAQRCMLVSK-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.11 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|