C35H31Cl3N4O3S — CID 126616925
4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-chlorobenzamide (PubChem CID 126616925) has the molecular formula C35H31Cl3N4O3S and a molecular weight of 694.08 g/mol. Its IUPAC name is 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-chlorobenzamide.
| Compound Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-chlorobenzamide |
|---|---|
| PubChem CID | 126616925 |
| Molecular Formula | C35H31Cl3N4O3S |
| Molecular Weight | 694.08 g/mol |
| Exact Mass | 692.12 |
| IUPAC Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonyl-2-chlorobenzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N2CCC(c3c4cc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)ccc4nn3C3CC3)CC2)cc1Cl |
| InChI | InChI=1S/C35H31Cl3N4O3S/c36-25-6-1-21(2-7-25)33(22-3-8-26(37)9-4-22)24-5-14-32-30(19-24)34(42(40-32)27-10-11-27)23-15-17-41(18-16-23)46(44,45)28-12-13-29(35(39)43)31(38)20-28/h1-9,12-14,19-20,23,27,33H,10-11,15-18H2,(H2,39,43) |
| InChIKey | JIUYQCMEOQFPDW-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.08 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|