C35H32Cl2N4O3S — CID 126616856
4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonylbenzamide (PubChem CID 126616856) has the molecular formula C35H32Cl2N4O3S and a molecular weight of 659.64 g/mol. Its IUPAC name is 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonylbenzamide.
| Compound Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 126616856 |
| Molecular Formula | C35H32Cl2N4O3S |
| Molecular Weight | 659.64 g/mol |
| Exact Mass | 658.16 |
| IUPAC Name | 4-[4-[5-[bis(4-chlorophenyl)methyl]-2-cyclopropylindazol-3-yl]piperidin-1-yl]sulfonylbenzamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)N2CCC(c3c4cc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)ccc4nn3C3CC3)CC2)cc1 |
| InChI | InChI=1S/C35H32Cl2N4O3S/c36-27-8-1-22(2-9-27)33(23-3-10-28(37)11-4-23)26-7-16-32-31(21-26)34(41(39-32)29-12-13-29)24-17-19-40(20-18-24)45(43,44)30-14-5-25(6-15-30)35(38)42/h1-11,14-16,21,24,29,33H,12-13,17-20H2,(H2,38,42) |
| InChIKey | BHARWYGADBALNN-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.64 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|