C29H31FO2 — CID 126620452
[2-fluoro-4-[(E)-pent-3-enyl]phenyl]-[4-[4-[(E)-pent-3-enyl]phenyl]phenoxy]methanol (PubChem CID 126620452) has the molecular formula C29H31FO2 and a molecular weight of 430.56 g/mol. Its IUPAC name is [2-fluoro-4-[(E)-pent-3-enyl]phenyl]-[4-[4-[(E)-pent-3-enyl]phenyl]phenoxy]methanol.
| Compound Name | [2-fluoro-4-[(E)-pent-3-enyl]phenyl]-[4-[4-[(E)-pent-3-enyl]phenyl]phenoxy]methanol |
|---|---|
| PubChem CID | 126620452 |
| Molecular Formula | C29H31FO2 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | [2-fluoro-4-[(E)-pent-3-enyl]phenyl]-[4-[4-[(E)-pent-3-enyl]phenyl]phenoxy]methanol |
| SMILES | C/C=C/CCc1ccc(-c2ccc(OC(O)c3ccc(CC/C=C/C)cc3F)cc2)cc1 |
| InChI | InChI=1S/C29H31FO2/c1-3-5-7-9-22-11-14-24(15-12-22)25-16-18-26(19-17-25)32-29(31)27-20-13-23(21-28(27)30)10-8-6-4-2/h3-6,11-21,29,31H,7-10H2,1-2H3/b5-3+,6-4+ |
| InChIKey | LOQKROOLZKJJIN-GGWOSOGESA-N |
| XLogP | 7.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|