C25H23F3O — CID 54000160
1-[4-[4-(difluoromethoxy)phenyl]phenyl]-2-fluoro-4-hex-4-enylbenzene (PubChem CID 54000160) has the molecular formula C25H23F3O and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-[4-[4-(difluoromethoxy)phenyl]phenyl]-2-fluoro-4-hex-4-enylbenzene.
| Compound Name | 1-[4-[4-(difluoromethoxy)phenyl]phenyl]-2-fluoro-4-hex-4-enylbenzene |
|---|---|
| PubChem CID | 54000160 |
| Molecular Formula | C25H23F3O |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[4-[4-(difluoromethoxy)phenyl]phenyl]-2-fluoro-4-hex-4-enylbenzene |
| SMILES | CC=CCCCc1ccc(-c2ccc(-c3ccc(OC(F)F)cc3)cc2)c(F)c1 |
| InChI | InChI=1S/C25H23F3O/c1-2-3-4-5-6-18-7-16-23(24(26)17-18)21-10-8-19(9-11-21)20-12-14-22(15-13-20)29-25(27)28/h2-3,7-17,25H,4-6H2,1H3 |
| InChIKey | KKZLAHJRUSAXBA-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|