C20H32N5O7P — CID 126658567
3-[(11S,13S,14R)-7-amino-13,14-dihydroxy-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-11-yl]pentan-3-yloxy-(3-hydroxypentan-3-yl)phosphinic acid (PubChem CID 126658567) has the molecular formula C20H32N5O7P and a molecular weight of 485.48 g/mol. Its IUPAC name is 3-[(11S,13S,14R)-7-amino-13,14-dihydroxy-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-11-yl]pentan-3-yloxy-(3-hydroxypentan-3-yl)phosphinic acid.
| Compound Name | 3-[(11S,13S,14R)-7-amino-13,14-dihydroxy-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-11-yl]pentan-3-yloxy-(3-hydroxypentan-3-yl)phosphinic acid |
|---|---|
| PubChem CID | 126658567 |
| Molecular Formula | C20H32N5O7P |
| Molecular Weight | 485.48 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 3-[(11S,13S,14R)-7-amino-13,14-dihydroxy-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraen-11-yl]pentan-3-yloxy-(3-hydroxypentan-3-yl)phosphinic acid |
| SMILES | CCC(CC)(OP(=O)(O)C(O)(CC)CC)[C@H]1c2nc3c(N)ncnc3n2C2OC1[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C20H32N5O7P/c1-5-19(6-2,32-33(29,30)20(28,7-3)8-4)10-14-12(26)13(27)18(31-14)25-16(10)24-11-15(21)22-9-23-17(11)25/h9-10,12-14,18,26-28H,5-8H2,1-4H3,(H,29,30)(H2,21,22,23)/t10-,12+,13-,14?,18?/m1/s1 |
| InChIKey | NWTQHHNZCIVJKD-PBWKEARKSA-N |
| XLogP | 1.39 |
| TPSA | 186.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|