C19H27N4O7P — CID 123376325
11-[3-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]pentan-3-yl]-7-methyl-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraene-13,14-diol (PubChem CID 123376325) has the molecular formula C19H27N4O7P and a molecular weight of 454.42 g/mol. Its IUPAC name is 11-[3-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]pentan-3-yl]-7-methyl-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraene-13,14-diol.
| Compound Name | 11-[3-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]pentan-3-yl]-7-methyl-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraene-13,14-diol |
|---|---|
| PubChem CID | 123376325 |
| Molecular Formula | C19H27N4O7P |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 11-[3-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]pentan-3-yl]-7-methyl-15-oxa-2,4,6,9-tetrazatetracyclo[10.2.1.02,10.03,8]pentadeca-3,5,7,9-tetraene-13,14-diol |
| SMILES | CCC(CC)(OP1(=O)OC1(O)CC)C1c2nc3c(C)ncnc3n2C2OC1C(O)C2O |
| InChI | InChI=1S/C19H27N4O7P/c1-5-18(6-2,29-31(27)19(26,7-3)30-31)10-14-12(24)13(25)17(28-14)23-15(10)22-11-9(4)20-8-21-16(11)23/h8,10,12-14,17,24-26H,5-7H2,1-4H3 |
| InChIKey | FNAFJUQHUKSCRV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 152.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|