C16H24N5O9P — CID 158026657
2-amino-9-[(2R,3R)-5-[2-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]-2-methylpropyl]-3,4-dihydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione (PubChem CID 158026657) has the molecular formula C16H24N5O9P and a molecular weight of 461.37 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R)-5-[2-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]-2-methylpropyl]-3,4-dihydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione.
| Compound Name | 2-amino-9-[(2R,3R)-5-[2-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]-2-methylpropyl]-3,4-dihydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 158026657 |
| Molecular Formula | C16H24N5O9P |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2-amino-9-[(2R,3R)-5-[2-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]-2-methylpropyl]-3,4-dihydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione |
| SMILES | CCC1(O)OP1(=O)OC(C)(C)CC1O[C@@H](n2c(=O)[nH]c3c(=O)[nH]c(N)nc32)[C@H](O)C1O |
| InChI | InChI=1S/C16H24N5O9P/c1-4-16(26)30-31(16,27)29-15(2,3)5-6-8(22)9(23)12(28-6)21-10-7(18-14(21)25)11(24)20-13(17)19-10/h6,8-9,12,22-23,26H,4-5H2,1-3H3,(H,18,25)(H3,17,19,20,24)/t6?,8?,9-,12-,16?,31?/m1/s1 |
| InChIKey | FGRJMTIHHHGXLL-HIUVTVMYSA-N |
| XLogP | -0.92 |
| TPSA | 218.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|