C18H28N5O9P — CID 147597622
2-amino-9-[(2R,3R)-5-[2-ethyl-2-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]butyl]-3,4-dihydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione (PubChem CID 147597622) has the molecular formula C18H28N5O9P and a molecular weight of 489.42 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R)-5-[2-ethyl-2-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]butyl]-3,4-dihydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione.
| Compound Name | 2-amino-9-[(2R,3R)-5-[2-ethyl-2-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]butyl]-3,4-dihydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione |
|---|---|
| PubChem CID | 147597622 |
| Molecular Formula | C18H28N5O9P |
| Molecular Weight | 489.42 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 2-amino-9-[(2R,3R)-5-[2-ethyl-2-[(3-ethyl-3-hydroxy-2-oxo-1,2λ5-oxaphosphiran-2-yl)oxy]butyl]-3,4-dihydroxyoxolan-2-yl]-1,7-dihydropurine-6,8-dione |
| SMILES | CCC(CC)(CC1O[C@@H](n2c(=O)[nH]c3c(=O)[nH]c(N)nc32)[C@H](O)C1O)OP1(=O)OC1(O)CC |
| InChI | InChI=1S/C18H28N5O9P/c1-4-17(5-2,31-33(29)18(28,6-3)32-33)7-8-10(24)11(25)14(30-8)23-12-9(20-16(23)27)13(26)22-15(19)21-12/h8,10-11,14,24-25,28H,4-7H2,1-3H3,(H,20,27)(H3,19,21,22,26)/t8?,10?,11-,14-,18?,33?/m1/s1 |
| InChIKey | FZMQFSOKMVZPHL-KYXMBTKRSA-N |
| XLogP | -0.14 |
| TPSA | 218.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.42 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|