C15H22N5O8P — CID 137043079
2-[(1R,3R,4R,5S)-3-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]propan-2-yloxy-ethylphosphinic acid (PubChem CID 137043079) has the molecular formula C15H22N5O8P and a molecular weight of 431.34 g/mol. Its IUPAC name is 2-[(1R,3R,4R,5S)-3-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]propan-2-yloxy-ethylphosphinic acid.
| Compound Name | 2-[(1R,3R,4R,5S)-3-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]propan-2-yloxy-ethylphosphinic acid |
|---|---|
| PubChem CID | 137043079 |
| Molecular Formula | C15H22N5O8P |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 2-[(1R,3R,4R,5S)-3-(2-amino-6,8-dioxo-1,7-dihydropurin-9-yl)-4,5-dihydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]propan-2-yloxy-ethylphosphinic acid |
| SMILES | CCP(=O)(O)OC(C)(C)C1[C@H]2O[C@@H](n3c(=O)[nH]c4c(=O)[nH]c(N)nc43)[C@H](O)[C@@]12O |
| InChI | InChI=1S/C15H22N5O8P/c1-4-29(25,26)28-14(2,3)6-8-15(6,24)7(21)11(27-8)20-9-5(17-13(20)23)10(22)19-12(16)18-9/h6-8,11,21,24H,4H2,1-3H3,(H,17,23)(H,25,26)(H3,16,18,19,22)/t6?,7-,8+,11+,15-/m0/s1 |
| InChIKey | VZPXDDLPNHXGIF-RMSLYHCZSA-N |
| XLogP | -1.39 |
| TPSA | 205.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|