C22H28N6O2 — CID 126674957
2-amino-5-[3-amino-5-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]pyridine-3-carboxamide (PubChem CID 126674957) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is 2-amino-5-[3-amino-5-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-amino-5-[3-amino-5-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126674957 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 2-amino-5-[3-amino-5-(4-pyrrolidin-1-ylpiperidine-1-carbonyl)phenyl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cc(-c2cc(N)cc(C(=O)N3CCC(N4CCCC4)CC3)c2)cnc1N |
| InChI | InChI=1S/C22H28N6O2/c23-17-10-14(16-12-19(21(25)29)20(24)26-13-16)9-15(11-17)22(30)28-7-3-18(4-8-28)27-5-1-2-6-27/h9-13,18H,1-8,23H2,(H2,24,26)(H2,25,29) |
| InChIKey | MZBRGVOFYHTBJQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|