C13H23N10P — CID 126676417
4-[[1-[(Z)-2-amino-3-[amino(methylphosphanyl)amino]prop-2-enyl]pyrazol-4-yl]methyl]-6-hydrazinylpyridine-2,5-diamine (PubChem CID 126676417) has the molecular formula C13H23N10P and a molecular weight of 350.37 g/mol. Its IUPAC name is 4-[[1-[(Z)-2-amino-3-[amino(methylphosphanyl)amino]prop-2-enyl]pyrazol-4-yl]methyl]-6-hydrazinylpyridine-2,5-diamine.
| Compound Name | 4-[[1-[(Z)-2-amino-3-[amino(methylphosphanyl)amino]prop-2-enyl]pyrazol-4-yl]methyl]-6-hydrazinylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 126676417 |
| Molecular Formula | C13H23N10P |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 4-[[1-[(Z)-2-amino-3-[amino(methylphosphanyl)amino]prop-2-enyl]pyrazol-4-yl]methyl]-6-hydrazinylpyridine-2,5-diamine |
| SMILES | CPN(N)/C=C(\N)Cn1cc(Cc2cc(N)nc(NN)c2N)cn1 |
| InChI | InChI=1S/C13H23N10P/c1-24-23(18)7-10(14)6-22-5-8(4-19-22)2-9-3-11(15)20-13(21-17)12(9)16/h3-5,7,24H,2,6,14,16-18H2,1H3,(H3,15,20,21)/b10-7- |
| InChIKey | SABBDIKVIDIWOA-YFHOEESVSA-N |
| XLogP | -0.48 |
| TPSA | 176.08 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|