C16H18BrNO2S — CID 12668036
6-phenylsulfanyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide (PubChem CID 12668036) has the molecular formula C16H18BrNO2S and a molecular weight of 368.30 g/mol. Its IUPAC name is 6-phenylsulfanyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide.
| Compound Name | 6-phenylsulfanyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide |
|---|---|
| PubChem CID | 12668036 |
| Molecular Formula | C16H18BrNO2S |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 6-phenylsulfanyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol;hydrobromide |
| SMILES | Br.Oc1cc2c(c(Sc3ccccc3)c1O)CCNCC2 |
| InChI | InChI=1S/C16H17NO2S.BrH/c18-14-10-11-6-8-17-9-7-13(11)16(15(14)19)20-12-4-2-1-3-5-12;/h1-5,10,17-19H,6-9H2;1H |
| InChIKey | BICCPBUSCXJJOF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|