C16H17NO2S — CID 12668035
6-phenylsulfanyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol (PubChem CID 12668035) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is 6-phenylsulfanyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol.
| Compound Name | 6-phenylsulfanyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
|---|---|
| PubChem CID | 12668035 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 6-phenylsulfanyl-2,3,4,5-tetrahydro-1H-3-benzazepine-7,8-diol |
| SMILES | Oc1cc2c(c(Sc3ccccc3)c1O)CCNCC2 |
| InChI | InChI=1S/C16H17NO2S/c18-14-10-11-6-8-17-9-7-13(11)16(15(14)19)20-12-4-2-1-3-5-12/h1-5,10,17-19H,6-9H2 |
| InChIKey | DHGAOMJHOQDVKM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|