C17H18BrNO2S — CID 53494977
(6aR,13bS)-6,6a,7,8,9,13b-hexahydrothiochromeno[4,3-a][3]benzazepine-11,12-diol;hydrobromide (PubChem CID 53494977) has the molecular formula C17H18BrNO2S and a molecular weight of 380.31 g/mol. Its IUPAC name is (6aR,13bS)-6,6a,7,8,9,13b-hexahydrothiochromeno[4,3-a][3]benzazepine-11,12-diol;hydrobromide.
| Compound Name | (6aR,13bS)-6,6a,7,8,9,13b-hexahydrothiochromeno[4,3-a][3]benzazepine-11,12-diol;hydrobromide |
|---|---|
| PubChem CID | 53494977 |
| Molecular Formula | C17H18BrNO2S |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | (6aR,13bS)-6,6a,7,8,9,13b-hexahydrothiochromeno[4,3-a][3]benzazepine-11,12-diol;hydrobromide |
| SMILES | Br.Oc1cc2c(cc1O)[C@H]1c3ccccc3SC[C@@H]1NCC2 |
| InChI | InChI=1S/C17H17NO2S.BrH/c19-14-7-10-5-6-18-13-9-21-16-4-2-1-3-11(16)17(13)12(10)8-15(14)20;/h1-4,7-8,13,17-20H,5-6,9H2;1H/t13-,17+;/m0./s1 |
| InChIKey | MVHPCYDYQFJLCA-OZIFAFRSSA-N |
| XLogP | 3.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|