C14H24N2O4 — CID 126684381
2-[3-(methoxymethylcarbamoyl)but-3-enyl-methylamino]ethyl 2-methylprop-2-enoate (PubChem CID 126684381) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-[3-(methoxymethylcarbamoyl)but-3-enyl-methylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-(methoxymethylcarbamoyl)but-3-enyl-methylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 126684381 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 2-[3-(methoxymethylcarbamoyl)but-3-enyl-methylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN(C)CCC(=C)C(=O)NCOC |
| InChI | InChI=1S/C14H24N2O4/c1-11(2)14(18)20-9-8-16(4)7-6-12(3)13(17)15-10-19-5/h1,3,6-10H2,2,4-5H3,(H,15,17) |
| InChIKey | KASLPVIABJMLPS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|