C29H61N — CID 126684746
6-ethyl-N,5,8,9,10,11,16-heptamethyl-14-propylheptadecan-1-amine (PubChem CID 126684746) has the molecular formula C29H61N and a molecular weight of 423.81 g/mol. Its IUPAC name is 6-ethyl-N,5,8,9,10,11,16-heptamethyl-14-propylheptadecan-1-amine.
| Compound Name | 6-ethyl-N,5,8,9,10,11,16-heptamethyl-14-propylheptadecan-1-amine |
|---|---|
| PubChem CID | 126684746 |
| Molecular Formula | C29H61N |
| Molecular Weight | 423.81 g/mol |
| Exact Mass | 423.48 |
| IUPAC Name | 6-ethyl-N,5,8,9,10,11,16-heptamethyl-14-propylheptadecan-1-amine |
| SMILES | CCCC(CCC(C)C(C)C(C)C(C)CC(CC)C(C)CCCCNC)CC(C)C |
| InChI | InChI=1S/C29H61N/c1-11-15-28(20-22(3)4)18-17-23(5)26(8)27(9)25(7)21-29(12-2)24(6)16-13-14-19-30-10/h22-30H,11-21H2,1-10H3 |
| InChIKey | NDXMYAKOBMWBRM-UHFFFAOYSA-N |
| XLogP | 9.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.81 |
| LogP ≤ 5 | 9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|