C17H18N2O3 — CID 126693816
(3S,4R)-3-amino-5-phenoxazin-10-yloxan-4-ol (PubChem CID 126693816) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (3S,4R)-3-amino-5-phenoxazin-10-yloxan-4-ol.
| Compound Name | (3S,4R)-3-amino-5-phenoxazin-10-yloxan-4-ol |
|---|---|
| PubChem CID | 126693816 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (3S,4R)-3-amino-5-phenoxazin-10-yloxan-4-ol |
| SMILES | N[C@H]1COCC(N2c3ccccc3Oc3ccccc32)[C@@H]1O |
| InChI | InChI=1S/C17H18N2O3/c18-11-9-21-10-14(17(11)20)19-12-5-1-3-7-15(12)22-16-8-4-2-6-13(16)19/h1-8,11,14,17,20H,9-10,18H2/t11-,14?,17+/m0/s1 |
| InChIKey | XBAMOKTZAXSFKS-BLBWXKFCSA-N |
| XLogP | 2.02 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |