C17H17NO3 — CID 149266160
(3S,4S)-3-phenoxazin-10-yloxan-4-ol (PubChem CID 149266160) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (3S,4S)-3-phenoxazin-10-yloxan-4-ol.
| Compound Name | (3S,4S)-3-phenoxazin-10-yloxan-4-ol |
|---|---|
| PubChem CID | 149266160 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | (3S,4S)-3-phenoxazin-10-yloxan-4-ol |
| SMILES | O[C@H]1CCOC[C@@H]1N1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C17H17NO3/c19-15-9-10-20-11-14(15)18-12-5-1-3-7-16(12)21-17-8-4-2-6-13(17)18/h1-8,14-15,19H,9-11H2/t14-,15-/m0/s1 |
| InChIKey | XQENAXJHQKSJDD-GJZGRUSLSA-N |
| XLogP | 3.08 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |