C20H31N — CID 126716182
1-[(1R)-4a-methyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]-N-methylmethanamine (PubChem CID 126716182) has the molecular formula C20H31N and a molecular weight of 285.48 g/mol. Its IUPAC name is 1-[(1R)-4a-methyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]-N-methylmethanamine.
| Compound Name | 1-[(1R)-4a-methyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 126716182 |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.48 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | 1-[(1R)-4a-methyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydro-1H-phenanthren-1-yl]-N-methylmethanamine |
| SMILES | CNC[C@@H]1CCCC2(C)c3ccc(C(C)C)cc3CCC12 |
| InChI | InChI=1S/C20H31N/c1-14(2)15-7-9-18-16(12-15)8-10-19-17(13-21-4)6-5-11-20(18,19)3/h7,9,12,14,17,19,21H,5-6,8,10-11,13H2,1-4H3/t17-,19?,20?/m0/s1 |
| InChIKey | VZLJCLHTKSLMAA-KKXNLOMOSA-N |
| XLogP | 4.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |