C9H18NO6P — CID 126718869
[3-[(2,3-dimethyl-4-oxobutyl)amino]-3-oxopropyl] dihydrogen phosphate (PubChem CID 126718869) has the molecular formula C9H18NO6P and a molecular weight of 267.22 g/mol. Its IUPAC name is [3-[(2,3-dimethyl-4-oxobutyl)amino]-3-oxopropyl] dihydrogen phosphate.
| Compound Name | [3-[(2,3-dimethyl-4-oxobutyl)amino]-3-oxopropyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 126718869 |
| Molecular Formula | C9H18NO6P |
| Molecular Weight | 267.22 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | [3-[(2,3-dimethyl-4-oxobutyl)amino]-3-oxopropyl] dihydrogen phosphate |
| SMILES | CC(C=O)C(C)CNC(=O)CCOP(=O)(O)O |
| InChI | InChI=1S/C9H18NO6P/c1-7(8(2)6-11)5-10-9(12)3-4-16-17(13,14)15/h6-8H,3-5H2,1-2H3,(H,10,12)(H2,13,14,15) |
| InChIKey | AQDVBNDWUPCYGY-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|