C23H42NO6P — CID 87977579
[2-hydroxy-3-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propyl] dihydrogen phosphate (PubChem CID 87977579) has the molecular formula C23H42NO6P and a molecular weight of 459.56 g/mol. Its IUPAC name is [2-hydroxy-3-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propyl] dihydrogen phosphate.
| Compound Name | [2-hydroxy-3-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 87977579 |
| Molecular Formula | C23H42NO6P |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | [2-hydroxy-3-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propyl] dihydrogen phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)NCC(O)COP(=O)(O)O |
| InChI | InChI=1S/C23H42NO6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)24-20-22(25)21-30-31(27,28)29/h3-4,6-7,9-10,22,25H,2,5,8,11-21H2,1H3,(H,24,26)(H2,27,28,29)/b4-3-,7-6-,10-9- |
| InChIKey | LMHSEVKOUYISOO-PDBXOOCHSA-N |
| XLogP | 4.94 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|